Zu "1700663-41-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
EPZ020411
Artikelnummer: Cay19160-1
EPZ020411 is an inhibitor of protein arginine methyltranferase 6 (PRMT6, IC50 = 10 nM) that less potently targets PRMT1 and PRMT8 (IC50s = 119 and 223 nM, respectively). It dose-dependently decreases methylation of the PRMT6 substrate H3R2 in A375 cells transiently expressing PRMT6 (IC50 = 0.637 µM). EPZ020411 shows...
| Schlagworte: | N1,N2-dimethyl-N1-[[3-[4-[[trans-3-[2-(tetrahydro-2H-pyran-4-yl)ethoxy]cyclobutyl]oxy]phenyl]-1H-pyrazol-4-yl]methyl]-1,2-... |
| Anwendung: | Potent, selective PRMT6 inhibitor |
| CAS | 1700663-41-7 |
| MW: | 442.6 D |
ab 71,00 €
EPZ020411
Artikelnummer: TGM-T4314-10mg
Description: EPZ020411 is a specific and effective inhibitor of PRMT6 (IC50=10 nM). Target: Histone Methyltransferase. Smiles: CNCCN(C)Cc1c[nH]nc1-c1ccc(O[C@H]2C[C@@H](C2)OCCC2CCOCC2)cc1. References: Mitchell LH, et al. Aryl Pyrazoles as Potent Inhibitors of Arginine Methyltransferases: Identification of the First...
| Schlagworte: | EPZ020411 2HCl |
| Anwendung: | Potent, selective PRMT6 inhibitor |
| CAS | 1700663-41-7 |
| MW: | 442.6 D |
ab 129,00 €
