Zu "1695533-44-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Erastin2
Artikelnummer: TGM-T35994-100mg
Target: Ferroptosis. Smiles: CC(C)Oc1ccc(cc1-n1c(CN2CCN(CC2)C(=O)COc2ccc(Cl)cc2)nc2ccccc2c1=O)-c1ccccc1. References: Cao, J.Y., Poddar, A., Magtanong, L., et al. A genome-wide haploid genetic screen identifies regulators of glutathione abundance and ferroptosis sensitivity. Cell Rep. 26(6), 1544-1556 (2019).
| Schlagworte: | 35MEW28 |
| Anwendung: | Ferroptosis inducer, cystine/glutamate transporter inhibitor |
| CAS | 1695533-44-8 |
| MW: | 623.14 D |
ab 67,00 €
Erastin2
Artikelnummer: Cay27087-1
Erastin2 is a ferroptosis inducer and an inhibitor of the system xc- cystine/glutamate transporter. It inhibits glutamate release in CCF-STTG1 cells (IC50 = 0.0035 µM). It induces cell death in HAP1 cells when used at a concentration of 5 µM, an effect that can be blocked by the ferroptosis inhibitor ferrostatin-1...
| Schlagworte: | 35MEW28,... |
| Anwendung: | Ferroptosis inducer, cystine/glutamate transporter inhibitor |
| CAS | 1695533-44-8 |
| MW: | 623.1 D |
ab 111,00 €
