Zu "168649-23-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5-Ph-IAA
Artikelnummer: TGM-T8885-100mg
Description: 5-Ph-IAA, a derivative of Indole-3-acetic acid (IAA), acts as a plant hormone and serves as an enzyme or prodrug combination for cancer gene therapy. Target: Others. Smiles: OC(=O)Cc1c[nH]c2ccc(cc12)-c1ccccc1. References: O Greco,et al. Horseradish peroxidase-mediated gene therapy: choice of prodrugs in...
| CAS | 168649-23-8 |
| MW: | 251.28 D |
ab 58,00 €
5-Ph-IAA
Artikelnummer: Cay38161-5
5-Ph-IAA is a phenylic substituted indole and ligand used for bump and hole, a technique used to study single protein isoforms when familial homology would interfere with other isoform-selective approaches. It activates a bump-and-hole-modified protein, transport inhibitor response 1 (TIR1), which forms a...
| Schlagworte: | 5-phenyl-1H-indole-3-acetic acid |
| Anwendung: | Phenylic substituted indole, bump and hole ligand |
| CAS | 168649-23-8 |
| MW: | 251.3 D |
ab 92,00 €
