Zu "168425-64-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Compound 401
Artikelnummer: Cay21769-1
Compound 401 is an inhibitor of DNA-dependent protein kinase (DNA-PK) and mammalian target of rapamycin (mTOR, IC50s = 0.28 and 5.3 µM, respectively). It is selective for DNA-PK and mTOR over PI3K, ATM, and ATR (IC50s = >100 µM for all). Compound 401 (10 µM) inhibits phosphorylation of the mTOR targets S6K1 and Akt...
| Schlagworte: | 2-(4-morpholinyl)-4H-pyrimido[2,1-a]isoquinolin-4-one |
| Anwendung: | DNA-PK / FRAP inhibitor |
| CAS | 168425-64-7 |
| MW: | 281.3 D |
ab 49,00 €
Compound 401
Artikelnummer: TGM-T3586-100mg
Description: Compound 401 (2-morpholino-4H-pyrimido[2,1-a]isoquinolin-4-one) is a synthetic DNA-PK inhibitor (IC50 = 0.28 µM) that also targets mTOR but not PI3K. Target: DNA-PK. Smiles: O=c1cc(nc2c3ccccc3ccn12)N1CCOCC1
| Schlagworte: | 2-morpholino-4H-pyrimido[2,1-a]isoquinolin-4-one |
| Anwendung: | DNA-PK / FRAP inhibitor |
| CAS | 168425-64-7 |
| MW: | 281.31 D |
ab 29,00 €
