Zu "168266-90-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vofopitant
Artikelnummer: TGM-T13329-100mg
Description: Vofopitant (GR 205171) is a potent NK1 receptor antagonist with anxiolytic and antiemetic activity for the study of post-traumatic stress disorder (PTSD). Target: Neurokinin receptor. Smiles: C(F)(F)(F)C=1N(N=NN1)C2=CC(CN[C@@H]3[C@@H](NCCC3)C4=CC=CC=C4)=C(OC)C=C2. References: Gardner CJ, et al....
| Schlagworte: | GR 205171 |
| CAS | 168266-90-8 |
| MW: | 432.44 D |
ab 95,00 €
Vofopitant
Artikelnummer: Cay42029-1
An NK1 receptor antagonist (Ki = 0.03 nM), selective for NK1 over NK2 and NK3 receptors (IC50s = >10,000 nM for both), 5-HT1A, 5-HT1D, and 5-HT2A receptors (Kis = 501, 251, and 316 nM, respectively), and histamine H1 and H2 receptors (Kis = 316 and 251 nM, respectively), inhibits resiniferatoxin-induced systemic...
| Schlagworte: | GR 205171, N-[[2S-methoxy-5-[5-(trifluoromethyl)-1H-tetrazol-1-yl]phenyl]methyl]-2-phenyl-3S-piperidinamine |
| Anwendung: | NK1 receptor antagonist |
| CAS | 168266-90-8 |
| MW: | 432.4 D |
ab 137,00 €
