Zu "16773-42-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ornidazole
Artikelnummer: TGM-T1556-500mg
Description: Ornidazole (Tiberal) is a nitroimidazole antiprotozoal agent used in ameba and trichomonas infections. It is partially plasma-bound and also has radiation-sensitizing action. Target: Parasite, Antibacterial, Antibiotic. Smiles: CC1=NC=C(N1CC(O)CCl)[N+]([O-])=O. References: Rutgeerts P et al....
| Schlagworte: | NSC 95075, Ro 7-0207, Tiberal, Ornidazolum |
| Anwendung: | Antibacterial, Antiprotozoal |
| CAS | 16773-42-5 |
| MW: | 219.63 D |
45,00 €
Ornidazole
Artikelnummer: Cay26818-5
Ornidazole is an orally bioavailable 5-nitroimidazole derivative with antibacterial and antiprotozoal activities. Ornidazole inhibits the growth of clinical isolates of B. fragilis (MICs = 0.5-5 µM) and various anaerobic bacteria when used at concentrations ranging from less than 0.1 to 3.2 µg/ml. It also inhibits...
| Schlagworte: | (±)-Ornidazole, NSC 95075, Ro 7-0207, alpha-(chloromethyl)-2-methyl-5-nitro-1H-imidazole-1-ethanol |
| Anwendung: | Antibacterial, antiprotozoal |
| CAS | 16773-42-5 |
| MW: | 219.6 D |
ab 85,00 €
Ornidazole
Artikelnummer: LKT-O6953.5
Used to treat some protozoan infections.
| Anwendung: | Antimicrobial agent |
| CAS | 16773-42-5 |
| MW: | 219,63 D |
ab 117,00 €
