Zu "1665-48-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Metaxalone
Artikelnummer: Cay15777-10
Metaxalone is a skeletal muscle relaxant. It inhibits the proliferation of, and induces apoptosis in, RAW 264.7 cells in vitro when used at concentrations ranging from 1 to 100 µM. Metaxalone also reduces LPS-induced increases in COX-1, COX-2, and NF-kB levels and inhibits LPS-induced production of TNF-alpha, IL-6,...
| Schlagworte: | AHR 438, NSC 170959, 5-[(3,5-dimethylphenoxy)methyl]-2-oxazolidinone |
| Anwendung: | Skeletal muscle relaxant |
| CAS | 1665-48-1 |
| MW: | 221.3 D |
ab 93,00 €
Metaxalone
Artikelnummer: TGM-T1610-100mg
Description: Metaxalone (Methaxalonum) (marketed by King Pharmaceuticals under the brand name Skelaxin ) is a muscle relaxant used to relax muscles and relieve pain caused by strains, sprains, and other musculoskeletal conditions. Target: Others. Smiles: CC1=CC(OCC2CNC(=O)O2)=CC(C)=C1. References: Nirogi RV, et al....
| Schlagworte: | Skelaxin, NSC170959, AHR438, Zorane, Methaxalonum |
| Anwendung: | Skeletal muscle relaxant |
| CAS | 1665-48-1 |
| MW: | 221.25 D |
ab 37,00 €
