Zu "165668-41-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Indisulam
Artikelnummer: TGM-T4321-10mg
Description: Indisulam (E 7070) is a carbonic anhydrase inhibitor and antitumor CDK inhibitor that targets the G1 phase of the cell cycle by depleting cyclin E, inducing p53 and p21, and inhibiting CDK2, thereby causing a blockade in the G1/S transition. Target: CDK, Carbonic Anhydrase. Smiles:...
| Schlagworte: | E 7070 |
| Anwendung: | Antineoplastic |
| CAS | 165668-41-7 |
| MW: | 385.85 D |
ab 31,00 €
Indisulam
Artikelnummer: Cay22759-5
Indisulam is a sulfonamide with anticancer activity. In vitro, indisulam has antiproliferative effects on a wide range of human tumor lines with HCT116 colorectal being the most sensitive and NCI-H596 non-small cell lung cancer (NSCLC) the most resistant (IC50s = 0.11 and 94 µg/ml, respectively). It increases the...
| Schlagworte: | E-7070, N1-(3-chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Anwendung: | Antineoplastic, RBM39 degradation inducer |
| CAS | 165668-41-7 |
| MW: | 385.8 D |
ab 35,00 €
