Zu "1644670-37-0" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Iptacopan
Iptacopan

Artikelnummer: TGM-T11864-100mg

Description: Iptacopan (LNP023) is an inhibitor with high affinity for factor B. Target: Others. Smiles: CCO[C@H]1CCN(Cc2c(OC)cc(C)c3[nH]ccc23)[C@@H](C1)c1ccc(cc1)C(O)=O. References: Schubart A, et al. Small-molecule factor B inhibitor for the treatment of complement-mediated diseases. Proc Natl Acad Sci U S A. 2019...
Schlagworte: LNP023
Anwendung: Targets complement factor B [EC:3.4.21.47] (CFB)
CAS 1644670-37-0
MW: 422.52 D
ab 51,00 €
Bewerten
LNP023
LNP023

Artikelnummer: Cay41833-1

LNP023 is a complement factor B (CFB) inhibitor (IC50 = 10 nM). It is selective for CFB over a panel of 41 proteases and 110 other enzymes, receptors, and ion channels (IC50s = >30 µM for all). LNP023 inhibits formation of the membrane attack complex induced by zymosan A (Cay-21175) in isolated human whole blood...
Schlagworte: Iptacopan, 4-[(2S,4S)-4-ethoxy-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-2-piperidinyl]-benzoic acid
Anwendung: Complement factor B (CFB) inhibitor
CAS 1644670-37-0
MW: 422.5 D
ab 53,00 €
Bewerten