Zu "1644545-52-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vorasidenib
Artikelnummer: TGM-T7307-100mg
Description: Vorasidenib (PVM/MA) is an inhibitor of mutant isocitrate dehydrogenase (IDH, IC50s = 31.9 and 31.7 nM for IDH1R132H and IDH2R140Q, respectively). Target: Isocitrate Dehydrogenase (IDH). Smiles: C[C@@H](Nc1nc(N[C@H](C)C(F)(F)F)nc(n1)-c1cccc(Cl)n1)C(F)(F)F. References: Zakkula A, Dittakavi S, Maniyar...
| Schlagworte: | AG-881, PVM/MA |
| Anwendung: | Targets isocitrate dehydrogenase [EC:1.1.1.42] (IDH1, IDH2, icd) |
| CAS | 1644545-52-7 |
| MW: | 414.74 D |
ab 48,00 €
Vorasidenib
Artikelnummer: Cay28462-1
Vorsidenib is an inhibitor of mutant isocitrate dehydrogenase (IDH, IC50s = 31.9 and 31.7 nM for IDH1R132H and IDH2R140Q, respectively). It also inhibits wild-type-IDH1R132H and wild-type-IDH2R140Q heterodimers (IC50s = 4 and 251 nM, respectively). Vorsidenib decreases the production of D-2-hydroxyglutarate (2-HG,...
| Schlagworte: | AG-881, 6-(6-chloro-2-pyridinyl)-N2,N4-bis[(1R )-2,2,2-trifluoro-1-methylethyl]-1,3,5-triazine-2,4-diamine |
| Anwendung: | Mutant isocitrate dehydrogenase (IDH1R132H, IDH2R140Q) inhibitor |
| CAS | 1644545-52-7 |
| MW: | 414.7 D |
ab 150,00 €
