Zu "1637356-98-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AS-2077715
Artikelnummer: TGM-T85044-10mg
Description: AS-2077715, an antifungal agent, exhibits inhibitory activity against Trichophyton species and is derived from the fermentation broth of Capnodium sp. 339855. It is utilized in the study of fungal infections [1]. Target: Others. Smiles: OC=1C(=CN(C)C(=O)C1C2OC(CCC(CC(CC)C)C)CCC2)C3C(O)C(O)C(O)C3O
| CAS | 1637356-98-9 |
| MW: | 467.6 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
AS-2077715
Artikelnummer: Cay29775-1
AS-2077715 is a fungal metabolite and an inhibitor of fungal mitochondrial complex III (cytochrome bc1, IC50 = 80 ng/ml for T. mentagrophytes complex III). It is selective for fungal over mammalian complex III (IC50s = 480 and 860 ng/ml for murine EL-4 cell and human Jurkat cell complex III, respectively)....
| Schlagworte: | 3-[6-(3,5-dimethylheptyl)tetrahydro-2H-pyran-2-yl]-4-hydroxy-1-methyl-5-(2,3,4,5-tetrahydroxycyclopentyl)-2(1H)-pyridinone |
| Anwendung: | Fungal complex III inhibitor |
| CAS | 1637356-98-9 |
| MW: | 467.6 D |
360,00 €
