Zu "1632236-44-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
KLH45
Artikelnummer: Cay19889-1
KLH45 is an inhibitor of the phospholipase DDHD domain containing 2 (DDHD2, IC50 = 1.3 nM). It is selective for DDHD2 over greater than 50 serine hydrolases, including DDHD1 and Sec23ip, but does inhibit alpha/beta-hydrolase domain-containing protein 6 (ABHD6). It inhibits DDHD2 and ABHD6 in Neuro2A cells when used...
| Schlagworte: | N-cyclohexyl-N-(2-phenylethyl)-4-[4-(trifluoromethoxy)phenyl]-2H-1,2,3-triazole-2-carboxamide |
| Anwendung: | DDHD2 inhibitor |
| CAS | 1632236-44-2 |
| MW: | 458.5 D |
ab 51,00 €
KLH45
Artikelnummer: TGM-T24263-10mg
Description: KLH45 is an effective and selective inhibitor of Spastic Paraplegia-Related Triglyceride Hydrolase DDHD2(IC50 = 1.3 nM). Target: Phosphatase. Smiles: FC(F)(F)Oc1ccc(cc1)-c1cnn(n1)C(=O)N(CCc1ccccc1)C1CCCCC1. References: Jordon M Inloes, et al. The hereditary spastic paraplegia-related enzyme DDHD2 is a...
| Schlagworte: | KLH-45, KLH 45 |
| CAS | 1632236-44-2 |
| MW: | 458.48 D |
ab 29,00 €
