Zu "162640-98-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AT-56
Artikelnummer: Cay13160-10
Prostaglandin D synthase (PGDS) catalyzes the isomerization of PGH2 to produce PGD2. PGD2 induces sleep, regulates nociception, inhibits platelet aggregation, and acts as an allergic mediator. Two distinct types of PGDS have been identified, namely the lipocalin-type enzyme (beta-trace, L-PGDS) and the...
| Schlagworte: | 4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-[4-(2H-tetrazol-5-yl)butyl]-piperidine |
| Anwendung: | L-PGDS inhibitor |
| CAS | 162640-98-4 |
| MW: | 397.5 D |
ab 56,00 €
AT-56
Artikelnummer: TGM-T1866-100mg
Description: AT56, a specific inhibitor of prostaglandin D2 synthase enzymatic activity, blunted adipogenic aldosterone effects. Target: PGE Synthase, Others. Smiles: C(CCc1nn[nH]n1)CN1CCC(CC1)=C1c2ccccc2C=Cc2ccccc12. References: Urbanet R, et al. Hypertension. 2015 Jul,66(1):149-57.
| Anwendung: | L-PGDS inhibitor |
| CAS | 162640-98-4 |
| MW: | 397.52 D |
ab 32,00 €
