Zu "161804-20-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Benzamil (hydrochloride)
Artikelnummer: Cay14313-10
Benzamil is a derivative of amiloride (Cay-14409). Benzamil is an epithelial sodium channel (ENaC) blocker that inhibits sodium transport from (IC50 = 4 nM) and binds to (Kd = 5 nM) bovine kidney cortex membrane vesicles. It is also an inhibitor of the Na+/Ca2+ exchanger (NCX) that inhibits the cytosolic calcium...
| Schlagworte: | 3,5-diamino-6-chloro-N-[imino[(phenylmethyl)amino]methyl]-2-pyrazinecarboxamide, monohydrochloride |
| Anwendung: | Epithelial sodium channel (ENaC) blocker |
| CAS | 161804-20-2 |
| MW: | 356.2 D |
ab 59,00 €
Benzamil hydrochloride
Artikelnummer: TGM-T22266-2mg
Description: Benzamil hydrochloride is a specific and potent sodium channel (ENaC) blocker. Target: Others. Smiles: Cl.Nc1nc(N)c(nc1Cl)C(=O)NC(=N)NCc1ccccc1
| Schlagworte: | Benzylamiloride hydrochloride |
| Anwendung: | Epithelial sodium channel (ENaC) blocker |
| CAS | 161804-20-2 |
| MW: | 356.21 D |
31,00 €
