Zu "1616391-87-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK591
Artikelnummer: Cay18354-1
GSK591 is a chemical probe for protein arginine methyltransferase 5 (PRMT5) that potently inhibits the PRMT5/MEP50 complex from methylating histone H4 (IC50 = 11 nM) in vitro. GSK591 is selective for PRMT5 (up to 50 µM) relative to a panel of other methyltransferases. In Z-138 cells, GSK591 inhibits the symmetric...
| Schlagworte: | EPZ015866, GSK3203591, 2-(cyclobutylamino)-N-[(2S)-3-(3,4-dihydro-2(1H)-isoquinolinyl)-2-hydroxypropyl]-4-pyridinecarboxamide |
| Anwendung: | PRMT5 chemical probe, PRMT5/MEP50 complex inhibitor |
| CAS | 1616391-87-7 |
| MW: | 380.5 D |
ab 49,00 €
GSK591
Artikelnummer: TGM-T6853-100mg
Description: GSK591 (GSK3203591), Alternative Names are EPZ015866, GSK3203591, is a potent selective inhibitor of the arginine methyltransferase PRMT5 (IC50=11 nM). Target: Histone Methyltransferase. Smiles: O[C@@H](CNC(=O)c1ccnc(NC2CCC2)c1)CN1CCc2ccccc2C1. References: SGC. GSK591 A chemical probe for PRMT5.
| Schlagworte: | GSK3203591 , EPZ015866 |
| Anwendung: | PRMT5 chemical probe, PRMT5/MEP50 complex inhibitor |
| CAS | 1616391-87-7 |
| MW: | 380.48 D |
ab 39,00 €
