Zu "161600-01-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MCC-555
Artikelnummer: Cay70735-1
The peroxisome proliferator-activated receptor-gamma (PPARgamma) is the nuclear receptor responsible for transducing the therapeutic activity of the thiazolidinediones (TZDs), a group of structurally related synthetic agonists with antidiabetic actions in vivo. Rosiglitazone (BRL49653) is a prototypical TZD and has...
| Schlagworte: | Isaglitazone, Netoglitazone, RWJ 241947, 5-[[6-[(2-fluorophenyl)methoxy]-2-naphthalenyl]methyl]-2,4-thiazolidinedione |
| Anwendung: | Peroxisome proliferator-activated receptor (PPAR) gamma modulator |
| CAS | 161600-01-7 |
| MW: | 381.4 D |
ab 69,00 €
MCC-555
Artikelnummer: TGM-T21764-100mg
Description: MCC-555 (Isaglitazone) is a PPARalpha and PPARgamma agonist exerting antihyperglycemic effects. Target: PPAR. Smiles: Fc1ccccc1COc1ccc2cc(CC3SC(=O)NC3=O)ccc2c1. References: Reginato MJ, et al. A potent antidiabetic thiazolidinedione with unique peroxisome proliferator-activated receptor gamma-activating...
| Schlagworte: | Netoglitazone, Isaglitazone |
| CAS | 161600-01-7 |
| MW: | 381.42 D |
ab 60,00 €
