Zu "161258-30-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Hexapeptide-11
Artikelnummer: TGM-TP2341-100mg
Description: Hexapeptide-11 is a novel proteostasis network modulator in human diploid fibroblasts. Smiles: C([C@@H](NC([C@@H](NC([C@H](CC1=CC=CC=C1)N)=O)[C@@H](C)C)=O)C)(=O)N2[C@H](C(N[C@H](C(=O)N3[C@H](C(O)=O)CCC3)CC4=CC=CC=C4)=O)CCC2. References: Sklirou AD, Ralli M, Dominguez M, Papassideri I, Skaltsounis AL,...
| Schlagworte: | Peptamide 6, Phe-val-ala-pro-phe-pro, Fvapfp |
| CAS | 161258-30-6 |
| MW: | 676.8 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Hexapeptide-11
Artikelnummer: CSB-DT1709.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Phe-Val-Ala-Pro-Phe-Pro, FVAPFP |
| Anwendung: | Cosmetic peptide |
| CAS | 161258-30-6 |
| MW: | 676.813 D |
248,00 €
