Zu "1609960-31-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TH588
Artikelnummer: Cay18133-1
Human mutT homolog (MTH1) is a nucleotide pool sanitizing enzyme that cleaves oxidized nucleotides (dNTPs) to prevent incorporation of damaged bases during DNA replication. Cancer cells rely on MTH1 activity in order to avoid cell death. TH588 is an MTH1 inhibitor (IC50 = 5 nM) with improved metabolic stability over...
| Schlagworte: | N4-cyclopropyl-6-(2,3-dichlorophenyl)-2,4-pyrimidinediamine |
| Anwendung: | MTH1 inhibitor |
| CAS | 1609960-31-7 |
| MW: | 295.2 D |
ab 49,00 €
TH588
Artikelnummer: TGM-T2037-100mg
Description: TH588 is nudix hydrolase family inhibitor that effectively and selectively engages and inhibits the MTH1(IC50: 5 nM) in cells. Target: MTH1, DNA/RNA Synthesis. Smiles: Nc1nc(NC2CC2)cc(n1)-c1cccc(Cl)c1Cl. References: Gad H, et al. Nature. 2014, 508(7495), 215-221.
| Anwendung: | MTH1 inhibitor |
| CAS | 1609960-31-7 |
| MW: | 295.17 D |
ab 34,00 €
