Zu "1609960-30-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TH287
Artikelnummer: Cay18132-1
Human mutT homolog (MTH1) is a nucleotide pool sanitizing enzyme that cleaves oxidized nucleotides (dNTPs) to prevent incorporation of damaged bases during DNA replication. Cancer cells rely on MTH1 activity in order to avoid cell death. TH287 is an MTH1 inhibitor (IC50 = 0.8 nM) that selectively kills cancer cell...
| Schlagworte: | 6-(2,3-dichlorophenyl)-N4-methyl-2,4-pyrimidinediamine |
| Anwendung: | MTH1 inhibitor |
| CAS | 1609960-30-6 |
| MW: | 269.1 D |
ab 69,00 €
TH287
Artikelnummer: TGM-T2069-100mg
Description: TH287 is a potent inhibitor of MTH1 (NUDT1), less potent for MTH2, NUDT5, NUDT12, NUDT14, and NUDT16. Target: DNA/RNA Synthesis, MTH1. Smiles: CNc1cc(nc(N)n1)-c1cccc(Cl)c1Cl. References: Gad H, et al. Nature. 2014, 508(7495), 215-221.
| Schlagworte: | TH287 hydrochloride |
| CAS | 1609960-30-6 |
| MW: | 269.13 D |
ab 30,00 €
