Zu "159013-54-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BIBP3226
Artikelnummer: Cay33210-1
BIBP3226 is a nonpeptide antagonist of neuropeptide Y (NPY) receptor Y1 (Ki = 1.1 nM). It is selective for Y1 over Y2, Y4, and Y5 receptors (Kis = >1,000 nM for all). It also binds to neuropeptide FF receptor 1 (NPFF1) and NPFF2 (Kis = 108 and 79 nM, respectively) and reverses NPFF-induced inhibition of...
| Schlagworte: | N-[(1R)-4-[(aminoiminomethyl)amino]-1-[[[(4-hydroxyphenyl)methyl]amino]carbonyl]butyl]-alpha-phenyl-benzeneacetamide |
| Anwendung: | NPY Y1 nonpeptide antagonist |
| CAS | 159013-54-4 |
| MW: | 473.6 D |
ab 76,00 €
BIBP3226
Artikelnummer: TGM-T26801-1mg
Description: BIBP3226 is a potent and selective antagonist for the Neuropeptide Y receptor (Y1) and the neuropeptide FF receptor (NPFF). Target: Others. Smiles: C(C(N[C@@H](C(NCC1=CC=C(O)C=C1)=O)CCCNC(=N)N)=O)(C2=CC=CC=C2)C3=CC=CC=C3. References: Fang Q, Guo J, He F, Peng YL, Chang M, Wang R. In vivo inhibition of...
| Schlagworte: | BIBP 3226, BIBP-3226 |
| Anwendung: | NPY Y1 nonpeptide antagonist |
| CAS | 159013-54-4 |
| MW: | 473.57 D |
ab 168,00 €
