Zu "15866-90-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Incyclinide
Artikelnummer: Cay34597-1
Incyclinide is a non-antimicrobial chemically modified tetracycline (CMT) and an inhibitor of matrix metalloproteinase-13 (MMP-13), MMP-1, and MMP-8 (IC50s = 0.3, 34, and 48 µg/ml, respectively). It inhibits chick osteoclast digestion of isolated bovine bone when used at a concentration of 5 µg/ml and inhibits...
| Schlagworte: | CMT-3, COL-3, NSC 683551,... |
| Anwendung: | MMP-13 / MMP-1 / MMP-8 inhibitor |
| CAS | 15866-90-7 |
| MW: | 371.3 D |
ab 93,00 €
Incyclinide
Artikelnummer: TGM-T15574-100mg
Description: Incyclinide (COL-3) is a matrix metalloproteinase (MMP) inhibitor. Thereby causing extracellular matrix degradation, tumor growth and invasion, and inhibiting angiogenesis, and metastasis. Target: MMP. Smiles: [H][C@@]12Cc3cccc(O)c3C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)C[C@]1([H])C2. References: Lee...
| Schlagworte: | CMT-3, COL-3 |
| Anwendung: | Antiacne, Antibacterial |
| CAS | 15866-90-7 |
| MW: | 371.34 D |
ab 76,00 €
