Zu "15818-46-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1,3-Dilinoleoyl Glycerol
Artikelnummer: Cay16481-100
1,3-Dilinoleoyl glycerol is an unsaturated diacylglycerol with linoleic acid (Cay-90150) (18:2) side-chains attached at both the C-1 and C-3 positions that is useful for lipid research.Formal Name: 9Z,12Z-octadecadienoic acid, 1,1'-(2-hydroxy-1,3-propanediyl) ester. CAS Number: 15818-46-9. Synonyms: 1,3-Dilinolein,...
| Schlagworte: | 1,3-Dilinolein, 1,3-Glyceryl dilinoleate, 9Z,12Z-octadecadienoic acid, 1,1'-(2-hydroxy-1,3-propanediyl) ester |
| Anwendung: | Unsaturated diacylglycerol |
| CAS | 15818-46-9 |
| MW: | 617 D |
ab 49,00 €
![1,3-Dilinoleoyl-rac-glycerol-[D5]](/custom/plugins/NetiThemeBiomol/Resources/Themes/Frontend/Biomol/frontend/_public/src/img/no-picture.jpg "1,3-Dilinoleoyl-rac-glycerol-[D5]")
1,3-Dilinoleoyl-rac-glycerol-[D5]
Artikelnummer: ISO-S14372-1.0
Isotope Incorporation: >98%
| Schlagworte: | Deuterium-labelled |
| Anwendung: | LC/MS internal standard |
| CAS | 15818-46-9 |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
1,3-Dilinoleoyl Glycerol
Artikelnummer: TGM-T84439-10mg
Description: 1,3-Dilinoleoyl glycerol, an unsaturated diacylglycerol featuring linoleic acid (18:2) side-chains at the C-1 and C-3 positions, is valuable for lipid research. Target: Others. Smiles: CCCCCC=CCC=CCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCC=CCC=CCCCCC
| Schlagworte: | 1,3-Dilinolein |
| CAS | 15818-46-9 |
| MW: | 616.968 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
