Zu "158081-99-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CP 105,696
Artikelnummer: Cay17620-1
CP 105,696 is an antagonist of the leukotriene B4 (LTB4) receptor (IC50 = 8.42 nM for the high-affinity receptor in human neutrophils). It inhibits chemotaxis induced by LTB4 (Cay-20110) in isolated human neutrophils (IC50 = 5 nM) and LTB4-induced calcium mobilization in isolated human monocytes (IC50 = 940 nM). CP...
| Schlagworte: | 1-[(3S,4R)-3-([1,1'-biphenyl]-4-ylmethyl)-3,4-dihydro-4-hydroxy-2H-1-benzopyran-7-yl]-cyclopentanecarboxylic acid |
| Anwendung: | LTB4 receptor antagonist |
| CAS | 158081-99-3 |
| MW: | 428.5 D |
ab 41,00 €
CP-105696
Artikelnummer: TGM-T15002-10mg
Description: CP-105696 is a potent and selective leukotriene B4 (LTB4) receptor antagonist used to study allograft rejection. Target: LTR. Smiles: O[C@@H]1[C@@H](Cc2ccc(cc2)-c2ccccc2)COc2cc(ccc12)C1(CCCC1)C(O)=O. References: Weringer EJ, et al. Antagonizing leukotriene B4 receptors delays cardiac allograft rejection...
| Schlagworte: | Pfizer 105696 |
| Anwendung: | LTB4 receptor antagonist |
| CAS | 158081-99-3 |
| MW: | 428.52 D |
ab 80,00 €
