Zu "1572510-42-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
JNJ-632
Artikelnummer: Cay26325-1
JNJ-632 is a modulator of hepatitis B virus (HBV) capsid assembly. It reduces viral DNA load in HBV-infected HepG2.2.15 cells (EC50 = 121 nM) without affecting cell growth. It also reduces viral DNA load in primary human hepatocytes infected with the HBV genotypes Ae, Bj, C, and D (EC50s = 101, 240, 119, and 200 nM,...
| Schlagworte: | N-(4-fluoro-3-methylphenyl)-3-[[[(3S)-tetrahydro-3-furanyl]amino]sulfonyl]-benzamide |
| Anwendung: | HVV capsid assembly modulator, HBV replication inhibitor |
| CAS | 1572510-42-9 |
| MW: | 378.4 D |
ab 69,00 €
JNJ-632
Artikelnummer: TGM-T4475-100mg
Description: JNJ-632 is a hepatitis B virus (HBV) capsid assembly modulator. Target: HBV. Smiles: Cc1cc(NC(=O)c2cccc(c2)S(=O)(=O)N[C@H]2CCOC2)ccc1F. References: Synthesis and Evaluation of N-Phenyl-3-sulfamoyl-benzamide Derivatives as Capsid Assembly Modulators Inhibiting Hepatitis B Virus (HBV)[J]. Journal of...
| CAS | 1572510-42-9 |
| MW: | 378.42 D |
ab 30,00 €
