Zu "157134-53-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Di-8-ANEPPS
Artikelnummer: TGM-T18973-1mg
Description: Di-8-ANEPPS, a voltage-sensitive dye, demonstrates shifts in both its fluorescence excitation and emission spectra in response to changes in membrane potential (Vm). Target: Others. Smiles: CCCCCCCCN(CCCCCCCC)c1ccc2cc(\C=C\c3cc[n+](CCCS([O-])(=O)=O)cc3)ccc2c1. References: Manno C, et al. Confocal...
| CAS | 157134-53-7 |
| MW: | 592.88 D |
ab 122,00 €
Di-8-ANEPPS
Artikelnummer: ABD-21497
Di-8-ANEPPS is widely used for monitoring fast membrane potential changes. ANEP dyes belong to the class of the fast-response membrane potential dyes. small, fast-response probes typically show a 2-10% fluorescence change per 100 mV.
| Anwendung: | Membrane potential studies |
| CAS | 157134-53-7 |
285,00 €
Di-8-ANEPPS
Artikelnummer: Cay19541-1
Di-8-ANEPPS is a potentiometric fluorescent dye that can be used to noninvasively measure transmembrane voltage. It is not fluorescent in water, but when bound to the lipid bilayer, becomes strongly fluorescent (ex/em max = ~467/631 nm). The fluorescence intensity of di-8-ANEPPS varies proportionally to changes in...
| Schlagworte: | 4-[2-[6-(dioctylamino)-2-naphthalenyl]ethenyl]-1-(3-sulfopropyl)-pyridinium, inner salt |
| Anwendung: | Potentiometric fluorescent dye, cell membrane marker |
| CAS | 157134-53-7 |
| MW: | 592.9 D |
ab 67,00 €
