Zu "156161-89-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BQ-788 sodium salt
Artikelnummer: TGM-T10595L-100mg
Description: BQ-788 sodium salt is a potent and selective antagonist of ETB receptor [ETB receptors] with an IC50 of 1.2 nM in human Girrardi heart cells. Target: Others. Smiles: [Na].CCCC[C@@H](NC(=O)[C@@H](Cc1cn(C(=O)OC)c2ccccc12)NC(=O)[C@H](CC(C)(C)C)NC(=O)N1[C@@H](C)CCC[C@H]1C)C(O)=O. References: Okada M, et al....
| CAS | 156161-89-6 |
| MW: | 664.8 D |
ab 283,00 €
BQ-788 . sodium salt
Artikelnummer: AG-CP3-0012-M001
White to off-white solid. Soluble in DMSO, 0.1M sodium bicarbonate or 100% ethanol. Slightly soluble in methanol. Insoluble in water. Potent and selective endothelin B receptor (ETBR) antagonist.
| Schlagworte: | ETB Receptor Antagonist,... |
| Anwendung: | Endothelin B receptor (EDNRB, ETBR) antagonist |
| CAS | 156161-89-6 |
| MW: | 663,8 D |
ab 176,00 €
BQ-788 (sodium salt)
Artikelnummer: Cay17403-1
BQ-788 is a peptide endothelin type B (ETB) receptor antagonist (IC50 = 1.2 nM). It is selective for ETB over ETA receptors (IC50 = 280 nM), as well as angiotensin, calcitonin, or neuropeptide receptors at 10 µM. BQ-788 inhibits calcium mobilization induced by endothelin-1 (ET-1) in human Girrardi heart cells (IC50...
| Schlagworte: | N-[[(2R,6S)-2,6-dimethyl-1-piperidinyl]carbonyl]-4-methyl-L-leucyl-1-(methoxycarbonyl)-D-tryptophyl-D-norleucine,... |
| Anwendung: | Potent, selective endothelin receptor type B antagonist |
| CAS | 156161-89-6 |
| MW: | 664.8 D |
ab 239,00 €
