Zu "154447-35-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NU 7026
Artikelnummer: Cay13308-5
DNA-dependent protein kinase (DNA-PK) binds to strand breaks produced during normal cellular processes or in response to genotoxic stresses, such as ionizing radiation, targeting substrates that facilitate DNA repair. NU 7026 is a cell-permeable, potent, specific, and ATP-competitive inhibitor of DNA-PK (IC50 = 230...
| Schlagworte: | DNA-PK Inhibitor II, LY293646, 2-(4-morpholinyl)-4H-naphtho[1,2-b]pyran-4-one |
| Anwendung: | DNA-PK inhibitor |
| CAS | 154447-35-5 |
| MW: | 281.3 D |
ab 122,00 €
NEU
NU 7026
Artikelnummer: TGM-T2433-100mg
Description: NU 7026 (DNA-PK Inhibitor II) is an effective DNA-PK inhibitor (IC50: 0.23 µM, in cell-free assays), 60-fold selective for DNA-PK than PI3K and no inhibition against both ATM and ATR. Target: DNA-PK, PI3K, ATM/ATR, Apoptosis. Smiles: O=C1C=2C(=C3C(=CC2)C=CC=C3)OC(=C1)N4CCOCC4. References: Veuger SJ,...
| Schlagworte: | NU7026, DNA-PK Inhibitor II, LY293646 |
| CAS | 154447-35-5 |
| MW: | 281.31 D |
ab 32,00 €
