Zu "154235-83-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ampalex
Artikelnummer: LKT-A5061.1
Benzylpiperidine, AMPA potentiator.
| Schlagworte: | CX-516 |
| Anwendung: | Benzylpiperidine, AMPA potentiator |
| CAS | 154235-83-3 |
| MW: | 241.29 D |
ab 136,00 €
CX-516
Artikelnummer: Cay14936-10
CX-516 is an AMPA receptor modulator. It increases the mean open time of AMPA receptors which increases the amplitude of trisynaptic responses to presynaptic stimulation in rat hippocampal slices. In vivo, CX-516 (10-50 mg/kg) accelerates acquisition of a conditioned fear response in rats in a dose-dependent manner....
| Schlagworte: | Ampalex, BDP-12, Benzoyl-Piperidine-12, 1-piperidinyl-6-quinoxalinyl-methanone |
| Anwendung: | AMPA modulator |
| CAS | 154235-83-3 |
| MW: | 241.3 D |
ab 78,00 €
CX516
Artikelnummer: TGM-T1884-100mg
Description: CX516 (Ampalex), an ampakine and nootropic, acts as an AMPA receptor positive allosteric modulator as a therapy for Alzheimer's disease, schizophrenia and mild cognitive impairment (MCI). Target: GluR, iGluR. Smiles: O=C(N1CCCCC1)C1=CC2=NC=CN=C2C=C1. References: Broberg BV, et al. Psychopharmacology...
| Schlagworte: | BDP 12, Ampalex, Ampakine CX516 |
| Anwendung: | AMPA modulator |
| CAS | 154235-83-3 |
| MW: | 241.29 D |
ab 29,00 €
