Zu "154039-60-8" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Marimastat
Marimastat

Artikelnummer: Cay14869-1

Marimastat is a broad-spectrum matrix metalloproteinase (MMP) inhibitor (IC50s = 5, 6, 230, 16, and 3 nM for MMP-1, MMP-2, MMP-3, MMP-7, and MMP-9, respectively). It also binds to a recombinantly expressed catalytic domain of human MMP-14 (MMP-14cat, Ki = 2.1 nM) and inhibits gelatinases (IC50s = 3-6 nM), fibroblast...
Schlagworte: BB-2516, KB-R8898,...
Anwendung: MMP inhibitor
CAS 154039-60-8
MW: 331.4 D
ab 69,00 €
Bewerten
Marimastat
Marimastat

Artikelnummer: TGM-T6885-1mg

Description: Marimastat (BB2516) (BB-2516) is a potent, broad spectrum matrix metalloprotease (MMP) inhibitor. MMP-9 (IC50=3 nM), MMP-1 (IC50=5 nM), MMP-2 (IC50=6 nM), MMP-14 (IC50=9 nM)and MMP-7 (IC50=13 nM). Target: MMP. Smiles: CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO)C(C)(C)C. References: Rasmussen HS,...
Schlagworte: BB2516, KB-R8898, TA2516
Anwendung: Targets matrix metalloproteinase-1 (interstitial collagenase) [EC:3.4.24.7] (MMP1)
CAS 154039-60-8
MW: 331.41 D
ab 51,00 €
Bewerten