Zu "1538604-68-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BLU-9931
Artikelnummer: Cay18405-1
Fibroblast growth factor receptor 4 (FGFR4) is the receptor for fibroblast growth factor 19 (FGF19), which is a tightly controlled hormone that regulates bile acid synthesis and hepatocyte proliferation in the normal liver. Aberrant signaling through the FGFR4/FGF19 signaling complex has been implicated in...
| Schlagworte: | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-quinazolinyl]amino]-3-methylphenyl]-2-propenamide |
| Anwendung: | FGFR4 inhibitor |
| CAS | 1538604-68-0 |
| MW: | 509.4 D |
ab 76,00 €
BLU9931
Artikelnummer: TGM-T2347-100mg
Description: BLU9931 is the first selective small molecule inhibitor of FGFR4. Target: FGFR. Smiles: COc1cc(OC)c(Cl)c(c1Cl)-c1ccc2nc(Nc3c(C)cccc3NC(=O)C=C)ncc2c1. References: Hagel M, et al. Cancer Discov. 2015, 5(4), 424-437.
| CAS | 1538604-68-0 |
| MW: | 509.38 D |
ab 30,00 €
