Zu "1538593-71-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Piperazine Erastin
Artikelnummer: Cay36934-500
Piperazine erastin is an inducer of ferroptosis. It inhibits glutamate release in human CCF-STTG1 astrocytoma cells (IC50 = 0.8 µM), indicating inhibition of the system xc- cystine/glutamate transporter, and decreases glutathione (GSH) levels in HT-1080 fibrosarcoma cells when used at a concentration of 10 µM....
| Schlagworte: | 2-[[4-[2-(4-chlorophenoxy)acetyl]-1-piperazinyl]methyl]-3-[2-(1-methylethoxy)-5-(1-piperazinylmethyl)phenyl]-4(3H)-quinazo... |
| Anwendung: | Ferroptosis inducer |
| CAS | 1538593-71-3 |
| MW: | 645.2 D |
ab 51,00 €
Piperazine Erastin
Artikelnummer: TGM-T16540-100mg
Description: Piperazine erastin, an analog of erastin, induces ferroptosis, an iron-dependent form of non-apoptotic cell death. Target: Ferroptosis. Smiles: C(C=1N(C(=O)C=2C(N1)=CC=CC2)C3=C(OC(C)C)C=CC(CN4CCNCC4)=C3)N5CCN(C(COC6=CC=C(Cl)C=C6)=O)CC5. References: Yang WS, et al. Regulation of ferroptotic cancer cell...
| CAS | 1538593-71-3 |
| MW: | 645.19 D |
ab 83,00 €
