Zu "153587-01-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NS 1619
Artikelnummer: Cay18876-10
NS 1619 is a calcium-dependent activator of large-conductance calcium-activated potassium (KCa1.1/BK) channels in vascular smooth muscle. It is typically used at a concentration of 30 µM to hyperpolarize the membrane potential of single myocytes during studies of smooth muscle relaxation and vasodilation. Studies...
| Schlagworte: | 1,3-dihydro-1-[2-hydroxy-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-2H-benzimidazol-2-one |
| Anwendung: | BKCa channel agonist |
| CAS | 153587-01-0 |
| MW: | 362.2 D |
ab 56,00 €
NS-1619
Artikelnummer: TGM-T3102-100mg
Description: NS1619 have cardio-protective effects after ischemia-reperfusion injury. Target: Apoptosis, Potassium Channel. Smiles: Oc1ccc(cc1-n1c2ccc(cc2[nH]c1=O)C(F)(F)F)C(F)(F)F. References: Kurra V, et al. BMC Nephrol. 2015 Mar 27,16:35.
| Anwendung: | BKCa channel agonist |
| CAS | 153587-01-0 |
| MW: | 362.23 D |
ab 30,00 €
