Zu "1533426-72-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SCR7
Artikelnummer: Cay18015-10
DNA ligase IV seals double-strand breaks during the process of nonhomologous end-joining in DNA repair. Inhibiting this function in cancer cells is one strategy to prevent deleterious cell growth. SCR7 is a small molecule inhibitor of DNA ligase IV that prevents nonhomologous end-joining by interfering with ligase...
| Schlagworte: | 2,3-dihydro-5,6-bis[(E)-(phenylmethylene)amino]-2-thioxo-4(1H)-pyrimidinone |
| Anwendung: | DNA ligase IV inhibitor |
| CAS | 1533426-72-0 |
| MW: | 334.4 D |
ab 51,00 €
SCR7
Artikelnummer: TGM-T3340-10mg
Description: SCR7, a specific DNA Ligase IV inhibitor, blocks nonhomologous end-joining (NHEJ). Target: DNA/RNA Synthesis, Apoptosis, CRISPR/Cas9. Smiles: O=c1[nH]c(=S)[nH]c(\N=C\c2ccccc2)c1\N=C\c1ccccc1. References: Srivastava M, et al. An inhibitor of nonhomologous end-joining abrogates double-strand break...
| Anwendung: | DNA ligase IV inhibitor |
| CAS | 1533426-72-0 |
| MW: | 334.4 D |
ab 174,00 €
