Zu "153312-59-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DORI
Artikelnummer: Cay38981-1
DORI is a cationic lipid that has been used in the formation of liposomes for the delivery of plasmid DNA in vitro.Formal Name: N-(2-hydroxyethyl)-N,N-dimethyl-2,3-bis[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]-1-propanaminium, monobromide. CAS Number: 153312-59-5. Synonyms: 1,2-Dioleoyl-3-dimethyl-hydroxyethylammonium...
| Schlagworte: | 1,2-Dioleoyl-3-dimethyl-hydroxyethylammonium bromide,... |
| Anwendung: | Cationic lipid, LNP formation |
| CAS | 153312-59-5 |
| MW: | 773 D |
ab 42,00 €
DORI
Artikelnummer: TGM-T84668-10mg
Description: DORI, a cationic lipid, efficiently delivers plasmid DNA in vitro, exhibiting lower cytotoxicity and high transfection efficiency [1]. Target: Others. Smiles: C(OC(CCCCCCC/C=C\CCCCCCCC)=O)(COC(CCCCCCC/C=C\CCCCCCCC)=O)C[N+](CCO)(C)C.[Br-]
| Schlagworte: | 1,2-Dioleoyl-3-dimethyl-hydroxyethylammonium bromide |
| CAS | 153312-59-5 |
| MW: | 773.02 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
