Zu "153168-05-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pleconaril
Artikelnummer: TGM-T4536-100mg
Description: Pleconaril (VP 63843) is a capsid inhibitor used previously to treat enterovirus infections. Pleconaril is effective in inhibiting replication (IC50: 50 nM). Target: Virus Protease, Antiviral. Smiles: Cc1cc(CCCOc2c(C)cc(cc2C)-c2noc(n2)C(F)(F)F)on1. References: Benschop KS, et al. Genetic and antigenic...
| Schlagworte: | Picovir, Win 63843, VP 63843 |
| Anwendung: | Antiviral |
| CAS | 153168-05-9 |
| MW: | 381.35 D |
ab 34,00 €
Pleconaril
Artikelnummer: Cay28461-10
Pleconaril is an antipicornaviral agent.{52019, 52020} It inhibits Picornaviridae viral replication by binding to a hydrophobic pocket in the major VP1 capsid protein, which prevents uncoating of the viral RNA genome. Pleconaril inhibits replication of the rhinoviruses HRV-A2 and HRV-B14 in HeLa Rh cells (EC50s =...
| Schlagworte: | VP 63843, Win 63843, 3-[3,5-dimethyl-4-[3-(3-methyl-5-isoxazolyl)propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
| Anwendung: | Antiviral, antipicornaviral agent |
| CAS | 153168-05-9 |
| MW: | 381.4 D |
ab 166,00 €
