Zu "151533-22-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Levomefolic acid calcium salt
Artikelnummer: LKT-L186860.1
| Schlagworte: | N-(4-(((2-amino-1,4,5,6,7,8-hexahydro-5-methyl-4-oxo-6-pteridinyl)methyl)amino)benzoyl)-L-glutamic acid calcium salt,... |
| Anwendung: | Methyl-group donor |
| CAS | 151533-22-1 |
| MW: | 497.51 D |
ab 116,00 €
Levomefolate calcium
Artikelnummer: TGM-T7593-100mg
Description: Levomefolate calcium, an artificial form of folate, is a coenzymated form of folic acid that offers a more bioavailable alternative in dietary supplements. Target: Antifolate. Smiles: [Ca++].CN1[C@@H](CNc2ccc(cc2)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)CNc2nc(N)[nH]c(=O)c12. References: Wiesinger H , Eydeler...
| Anwendung: | Supplement (folic acid) |
| CAS | 151533-22-1 |
| MW: | 497.52 D |
ab 30,00 €
