Zu "150725-87-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ro 46-2005
Artikelnummer: Cay43523-10
An ETA and ETB antagonist (IC50s = 220 and 160 nM, respectively), inhibits endothelin-1-induced secretion of arachidonic acid in primary rat mesangial cells (IC50 = 1.8 µM), prevents sarafotoxin S6-induced relaxation in preconstricted rat mesenteric arteries (pA2 = 6.47), increases cerebral blood flow in a rat model...
| Schlagworte: | 4-(1,1-dimethylethyl)-N-[6-(2-hydroxyethoxy)-5-(3-methoxyphenoxy)-4-pyrimidinyl]-benzenesulfonamide |
| Anwendung: | Endothelin receptor type A/B antagonist |
| CAS | 150725-87-4 |
| MW: | 473.54 D |
ab 87,00 €
Ro 46-2005
Artikelnummer: TGM-T3194-100mg
Description: Ro 46-2005 is a synthetic non-peptide endothelin receptor antagonist, inhibits the specific binding of 125I-ET-1 to human vascular smooth muscle cells (ETA receptor, IC50: 220 nM). Target: Endothelin Receptor. Smiles: COc1cccc(Oc2c(NS(=O)(=O)c3ccc(cc3)C(C)(C)C)ncnc2OCCO)c1. References: Breu V, et al....
| CAS | 150725-87-4 |
| MW: | 473.54 D |
ab 37,00 €
