Zu "150338-90-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
C2 L-erythro Ceramide (d18:1/2:0)
Artikelnummer: Cay24387-1
C2 L-erythro Ceramide is a bioactive sphingolipid and a cell-permeable analog of naturally occurring ceramides. It stimulates cholesterol efflux in CHO cells expressing the human ABCA1 receptor when used at a concentration of 10 µM, however, this efflux is >50% less than that stimulated by C2 ceramide (Cay-62510)....
| Schlagworte: | L-erythro Cer(d18:1/2:0), L-erythro Ceramide (d18:1/2:0), N-acetyl-L-erythro-Sphingosine,... |
| Anwendung: | Bioactive sphingolipid |
| CAS | 150338-90-2 |
| MW: | 341.5 D |
283,00 €
C2 L-erythro Ceramide (d18:1/2:0)
Artikelnummer: TGM-T85188-10mg
Target: Others. Smiles: CCCCCCCCCC CCC\C=C\[C@H](O)[C@@H](CO)NC(C)=O
| Schlagworte: | N-acetyl-L-erythro-Sphingosine, L-erythro Ceramide (d18:1/2:0), L-erythro Cer(d18:1/2:0) |
| CAS | 150338-90-2 |
| MW: | 341.536 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
