Zu "149759-96-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
FTase Inhibitor I
Artikelnummer: Cay22755-1
FTase inhibitor I is a potent inhibitor of farnesyltransferase (FTase, IC50 = 21 nM) that is greater than 30-fold selective for FTase over geranylgeranyl transferase (GGTase, IC50 = 790 nM). It prevents farnesylation of Ras and inhibits proliferation of cells transformed by Ras farnesylation. In a dog model of...
| Schlagworte: | Farnesyltransferase Inhibitor I, N-[(2S)-2-[[(2R)-2-amino-3-mercaptopropyl]amino]-3-methylbutyl]-L-phenylalanyl-L-methionine |
| Anwendung: | Potent farnesyltransferase inhibitor |
| CAS | 149759-96-6 |
| MW: | 470.7 D |
ab 110,00 €
B 581
Artikelnummer: TGM-T19790-1mg
Description: B 581 is an inhibitor that specifically blocks farnesylated. Target: Others. Smiles: [C@H](CC1=CC=CC=C1)(C(N[C@@H](CCSC)C(O)=O)=O)NC[C@@H](NC[C@H](CS)N)[C@@H](C)C. References: Cox AD, Garcia AM, Westwick JK, Kowalczyk JJ, Lewis MD, Brenner DA, Der CJ. The CAAX peptidomimetic compound B581 specifically...
| Schlagworte: | B-581, B581 |
| Anwendung: | Potent farnesyltransferase inhibitor |
| CAS | 149759-96-6 |
| MW: | 470.69 D |
ab 250,00 €
