Zu "1470018-52-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AMG 2850
Artikelnummer: Cay42906-1
AMG 2850 is an antagonist of transient receptor potential melastatin 8 (TRPM8). It inhibits menthol- or cold-induced intracellular calcium release in CHO cells expressing rat TRPM8 (IC50s = 7. and 150 nM, respectively). AMG 2850 is selective for TRPM8 over transient receptor potential ankyrin 1 (TRPA1), transient...
| Schlagworte: | 5,8R-dihydro-N-[(1S)-2,2,2-trifluoro-1-methylethyl]-8-[4-(trifluoromethyl)phenyl]-1,7-naphthyridine-7(6H)-carboxamide |
| Anwendung: | TRPM8 antagonist |
| CAS | 1470018-52-0 |
| MW: | 417.36 D |
ab 102,00 €
AMG2850
Artikelnummer: TGM-T10300-100mg
Description: AMG2850 is a potent, orally bioavailable, and selective antagonist of transient receptor potential melastatin 8 [TRPM8]. Target: TRP/TRPV Channel. Smiles: C[C@H](NC(=O)N1CCc2cccnc2[C@H]1c1ccc(cc1)C(F)(F)F)C(F)(F)F. References: Lehto SG, et al. AMG2850, a potent and selective TRPM8 antagonist, is not...
| CAS | 1470018-52-0 |
| MW: | 417.35 D |
ab 65,00 €
