Zu "14698-29-4" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Oxolinic Acid
Artikelnummer: Cay16789-1
Bacterial DNA gyrase is a heterodimeric type II topoisomerase that negatively supercoils circular double-stranded DNA. Oxolinic acid is a quinolone antibiotic that inhibits bacterial DNA gyrase, but not eukaryotic topoisomerases, reversibly binding gyrase subunit A in gyrase-DNA complexes, blocking supercoiling...
| Schlagworte: | NSC 110364, Urinox, 5-ethyl-5,8-dihydro-8-oxo-1,3-dioxolo[4,5-g]quinoline-7-carboxylic acid |
| Anwendung: | Antibiotic, gyrase inhibitor |
| CAS | 14698-29-4 |
| MW: | 261.2 D |
ab 51,00 €
Oxolinic acid
Artikelnummer: LKT-O9458.25
A quinolone antibiotic agent that inhibits the enzyme DNA gyrase. Also may act as a dopamine reuptake inhibitor.
| Anwendung: | DNA gyrase inhibitor |
| CAS | 14698-29-4 |
| MW: | 261,23 D |
ab 140,00 €
Oxolinic Acid
Artikelnummer: LKT-O9458.1
A quinolone antibiotic agent that inhibits the enzyme DNA gyrase. Also may act as a dopamine reuptake inhibitor.
| Anwendung: | DNA gyrase inhibitor |
| CAS | 14698-29-4 |
| MW: | 261.23 D |
82,00 €
NEU
Oxolinic acid
Artikelnummer: TGM-T1233-1g
Description: Oxolinic acid (Nidantin) is a synthetic antimicrobial related to NALIDIXIC ACID and used in URINARY TRACT INFECTIONS. Target: Antibiotic, DNA/RNA Synthesis, Antibacterial, Dopamine Receptor. Smiles: CCn1cc(C(O)=O)c(=O)c2cc3OCOc3cc12. References: Izawa A, et al. Antimicrob Agents Chemother. 1980,...
| Schlagworte: | Urinox, Dioxacin, NSC 110364, Nidantin, Emyrenil |
| Anwendung: | Antibacterial, Nucleic acid biosynthesis inhibitor |
| CAS | 14698-29-4 |
| MW: | 261.23 D |
ab 30,00 €
