Zu "1467057-23-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PF-06409577
Artikelnummer: Cay27366-1
PF-06409577 is an activator of AMP-activated protein kinase (AMPK) heterotrimers (Kd = 9 nM for alpha1beta1gamma1). In vitro, it selectively activates beta1-containing AMPK isoforms (EC50s = 2.18-7.03 nM) over beta2-containing isoforms (EC50s = >10 µM). PF-06409577 has an EC50 value of 7 nM in an...
| Schlagworte: | 6-chloro-5-[4-(1-hydroxycyclobutyl)phenyl]-1H-indole-3-carboxylic acid |
| Anwendung: | AMPK heterotrimer activator |
| CAS | 1467057-23-3 |
| MW: | 341.8 D |
ab 49,00 €
PF-06409577
Artikelnummer: TGM-T4427-100mg
Description: PF-06409577 is an effective, orally active, and specific allosteric activator of AMPK (EC50: 7 nM, for alpha1beta1gamma1). Target: AMPK. Smiles: OC(=O)c1c[nH]c2cc(Cl)c(cc12)-c1ccc(cc1)C1(O)CCC1. References: Cameron K O, Kung D W, Kalgutkar A S, et al. Discovery and preClinicalal characterization of...
| Schlagworte: | PF 06409577 |
| Anwendung: | AMPK heterotrimer activator |
| CAS | 1467057-23-3 |
| MW: | 341.79 D |
ab 37,00 €
