Zu "1467047-25-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SRS11-92
Artikelnummer: Cay25689-1
SRS11-92 is a ferroptosis inhibitor and a derivative of ferrostatin-1 (Cay-17729). It inhibits ferroptotic cell death induced by erastin (Cay-17754) in HT-1080 human fibrosarcoma cells (EC50 = 6 nM). SRS11-92 (2 µM) inhibits iron-induced cell death in isolated mouse kidney proximal tubules, and fully protects rat...
| Schlagworte: | AA9, 4-(cyclohexylamino)-3-[(phenylmethyl)amino]-benzoic acid, ethyl ester |
| Anwendung: | Ferroptosis inhibitor |
| CAS | 1467047-25-1 |
| MW: | 352.5 D |
ab 53,00 €
SRS11-92
Artikelnummer: TGM-T8922-100mg
Description: SRS11-92 (AA9) is a ferroptosis inhibitor and a derivative of ferrostatin-1. Target: Ferroptosis. Smiles: CCOC(=O)c1ccc(NC2CCCCC2)c(NCc2ccccc2)c1. References: Skouta, Rachid, Perez, et al. Novel arylalkylamine compounds exhibits potent selective antiparasitic activity against Leishmania major[J]....
| Schlagworte: | AA9 |
| CAS | 1467047-25-1 |
| MW: | 352.47 D |
ab 37,00 €
