Zu "146062-49-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MSDC-0160
Artikelnummer: Cay71748-10
MSDC-0160 is a thiazolidinedione (TZD) with antidiabetic and neuroprotective activities. It inactivates the mitochondrial pyruvate carrier (MPC, IC50 = 1.2 µM) without affecting peroxisome proliferator-activated receptor gamma (PPARgamma, IC50 = 31.65 µM) in vitro. MSDC-0160 enhances the rate of insulin-stimulated...
| Schlagworte: | 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-2,4-thiazolidinedione |
| Anwendung: | PPARgamma agonist |
| CAS | 146062-49-9 |
| MW: | 370.4 D |
ab 58,00 €
MSDC 0160
Artikelnummer: TGM-T2607-100mg
Description: MSDC 0160 (CAY10415) is a prototype mTOT-modulating insulin sensitizer being used in trials studying the treatment of Type 2 Diabetes and Alzheimer's Disease. Target: IGF-1R, Mitochondrial Metabolism, Others. Smiles: CCc1ccc(nc1)C(=O)COc1ccc(CC2SC(=O)NC2=O)cc1. References: Rohatgi N, et al. PLoS One....
| Schlagworte: | MSDC0160, MSDC-0160, Mitoglitazone, CAY10415 |
| Anwendung: | PPARgamma agonist |
| CAS | 146062-49-9 |
| MW: | 370.42 D |
ab 30,00 €
