Zu "1456551-16-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
JG-98
Artikelnummer: TGM-T5350-100mg
Description: JG-98 is an allosteric Hsp70 inhibitor, displays high active against the breast cancer cell lines MDA-MB-231 and MCF-7 (EC50s: 0.4/0.7 µM). Target: HSP, Apoptosis. Smiles: [Cl-].CCn1\c(=C\c2scc[n+]2Cc2ccccc2)s\c(=C2\Sc3cc(Cl)ccc3N2C)c1=O. References: Li X, et al. Analogs of the Allosteric Heat Shock...
| Schlagworte: | JG 98, JG98 |
| Anwendung: | The Hsp70-BAG-3 protein-protein interaction inhibitor |
| CAS | 1456551-16-8 |
| MW: | 534.53 D |
ab 102,00 €
JG-98
Artikelnummer: Cay38337-1
JG-98 is an inhibitor of the protein-protein interaction between heat shock protein 70 (Hsp70) and Bcl-2-associated athanogene 3 (BAG-3, IC50 = 1.6 µM). It reduces the proliferation of MDA-MB-231 and MCF-7 breast cancer cells (EC50s = 0.4 and 0.7 µM, respectively) and 22 other cancer cell lines (EC50s = 0.3-4 µM)....
| Schlagworte: | 2-[(Z)-[(5E)-5-(6-chloro-3-methyl-2(3H)-benzothiazolylidene)-3-ethyl-4-oxo-2-thiazolidinylidene]methyl]-3-(phenylmethyl)-t... |
| Anwendung: | The Hsp70-BAG-3 protein-protein interaction inhibitor |
| CAS | 1456551-16-8 |
| MW: | 534.5 D |
ab 49,00 €
