Zu "1453071-47-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TC-E 5002
Artikelnummer: Cay17717-5
TC-E 5002 is an inhibitor of the histone lysine demethylase (KDM) subfamily KDM2/7 (IC50s = 6.8, 0.2, and 1.2 µM for KDM2A, KDM7A, and KDM7B, respectively). It is selective for the KDM2/7 subfamily over KDM4A, KDM4C, KDM5A, and KDM6A/UTX (IC50s = >120, 83, 55, and 100 µM, respectively). It inhibits the growth of...
| Schlagworte: | N-(9-cyclopropyl-1-oxononyl)-N-hydroxy-beta-alanine |
| Anwendung: | Selective histone demethylase KDM2/7 subfamily inhibitor |
| CAS | 1453071-47-0 |
| MW: | 285.4 D |
ab 55,00 €
KDM2/7-IN-1
Artikelnummer: TGM-T23429-10mg
Description: Selective histone demethylase KDM2/7 subfamily inhibitor. Target: Others. Smiles: C(CCCCCCCC(N(CCC(O)=O)O)=O)C1CC1
| Schlagworte: | TC-E 5002 |
| CAS | 1453071-47-0 |
| MW: | 285.38 D |
ab 98,00 €
