Zu "1448867-41-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Siremadlin
Artikelnummer: TGM-T5555-10mg
Description: Siremadlin (NVP-HDM 201) is a potent, orally bioavailable and highly specific p53-MDM2 interaction inhibitor. Target: E1/E2/E3 Enzyme. Smiles: COc1ncc(-c2nc3C(=O)N([C@H](c3n2C(C)C)c2ccc(Cl)cc2)c2cc(Cl)cn(C)c2=O)c(OC)n1. References: Chapeau EA, et al. Resistance mechanisms to TP53-MDM2 inhibition...
| Schlagworte: | NVP-HDM 201 |
| Anwendung: | Targets E3 ubiquitin-protein ligase Mdm2 [EC:2.3.2.27] (MDM2) |
| CAS | 1448867-41-1 |
| MW: | 555.41 D |
ab 60,00 €
Siremadlin
Artikelnummer: Cay38516-1
Siremadlin is an inhibitor of the protein-protein interaction between the E3 ubiquitin ligase MDM2 and p53 (IC50 = 0.21 nM). It selectively inhibits the MDM2-p53 protein-protein interaction over MDM4-p53, YAP1-TEAD4, PCSK9-LDLR, and Bcl-2-Bak interactions in time-resolved FRET (TR-FRET) assays (IC50s = 3.3, >150,...
| Schlagworte: | HDM201, NVP-HDM201,... |
| Anwendung: | MDM2-p53 protein-protein interaction inhibitor |
| CAS | 1448867-41-1 |
| MW: | 555.4 D |
ab 40,00 €
