Zu "144494-65-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tirofiban
Artikelnummer: TGM-T6182-100mg
Description: Tirofiban (L700462) (MK-383) is a selective palate GPIIb/IIIa antagonist which inhibits platelet aggregation with IC50 of 9 nM. Target: Integrin. Smiles: CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCC2CCNCC2)cc1)C(O)=O. References: Hartman GD, et al. J Med Chem, 1992, 35(24), 4640-4642.
| Schlagworte: | L700462, MK383, Aggrastat |
| Anwendung: | Platelet aggregation inhibitor, Glycoprotein IIb/IIIa receptor antagonist |
| CAS | 144494-65-5 |
| MW: | 440.6 D |
ab 39,00 €
Tirofiban
Artikelnummer: CDX-T0153-M005
Off-white powder. Sligthly soluble in ethanol or water. Synthetic non-peptide selective glycoprotein (GP) IIb/IIIa receptor antagonist/inhibitor. Anticoagulant, specifically, an anti-platelet aggregation inhibitor.
| Schlagworte: | MK-383, L-700,462, (2S)-2-(Butylsulfonylamino)-3-{4-[4-(4-piperidyl)butoxy}phenyl propanoic acid,... |
| Anwendung: | Glycoprotein (GP) IIb/IIIa receptor antagonist/inhibitor, anticoagulant |
| CAS | 144494-65-5 |
| MW: | 440,6 D |
ab 122,00 €
