Zu "1429651-50-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
HPOB
Artikelnummer: Cay15066-1
HPOB is a potent inhibitor of histone deacetylase 6 (HDAC6, IC50 = 56 nM). It is at least 30-fold less effective against other HDACs. Through its effects on HDAC6, HPOB induces acetylation of alpha-tubulin but not histones. HPOB reduces the growth, but not the viability, of normal and transformed cells. It enhances...
| Schlagworte: | 4-[(hydroxyamino)carbonyl]-N-(2-hydroxyethyl)-N-phenyl-benzeneacetamide |
| Anwendung: | HDAC6 inhibitor |
| CAS | 1429651-50-2 |
| MW: | 314.3 D |
ab 49,00 €
NEU
HPOB
Artikelnummer: TGM-T2430-10mg
Description: HPOB is an effective and specific HDAC6 inhibitor (IC50: 56 nM), >30-fold selectivity over other HDACs. Target: HDAC, Apoptosis. Smiles: OCCN(C(=O)Cc1ccc(cc1)C(=O)NO)c1ccccc1. References: Lee JH, et al. Proc Natl Acad Sci U S A. 2013, 110(39), 15704-157099.
| CAS | 1429651-50-2 |
| MW: | 314.34 D |
ab 48,00 €
