Zu "142720-24-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
FGIN-1-27
Artikelnummer: Cay18461-10
FGIN-1-27 is an indoleacetamide that acts as a high affinity agonist of the 18 kDa translocator protein (TSPO, previously called the peripheral benzodiazepine receptor) with a Ki value of 5 nM. It can enhance steroidogenesis of neuroactive steroids such as allopregnanolone (Cay-16930). Through this action, FGIN-1-27...
| Schlagworte: | 2-(4-fluorophenyl)-N,N-dihexyl-1H-indole-3-acetamide |
| Anwendung: | TSPO agonist |
| CAS | 142720-24-9 |
| MW: | 436.6 D |
ab 58,00 €
FGIN-1-27
Artikelnummer: TGM-T22782-100mg
Description: FGIN-1-27 is a high-affinity agonist of the translocator protein and a specific peripheral benzodiazepine receptor (PBR) ligand(Ki = 5.0 nM). FGIN 1-27 can cross the blood-brain barrier. Target: Others. Smiles: CCCCCCN(CCCCCC)C(=O)Cc1c([nH]c2ccccc12)-c1ccc(F)cc1. References: Michelle L James, et al....
| CAS | 142720-24-9 |
| MW: | 436.6 D |
ab 30,00 €
